C22H36O5 — CID 163025248
[(1S,2S,4S,5E,9R,10S)-9-[(3S)-3-hydroperoxy-4-methylpent-4-enyl]-2-hydroxy-2,6,9-trimethyl-4-bicyclo[8.1.0]undec-5-enyl] acetate (PubChem CID 163025248) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(1S,2S,4S,5E,9R,10S)-9-[(3S)-3-hydroperoxy-4-methylpent-4-enyl]-2-hydroxy-2,6,9-trimethyl-4-bicyclo[8.1.0]undec-5-enyl] acetate.
| Compound Name | [(1S,2S,4S,5E,9R,10S)-9-[(3S)-3-hydroperoxy-4-methylpent-4-enyl]-2-hydroxy-2,6,9-trimethyl-4-bicyclo[8.1.0]undec-5-enyl] acetate |
|---|---|
| PubChem CID | 163025248 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(1S,2S,4S,5E,9R,10S)-9-[(3S)-3-hydroperoxy-4-methylpent-4-enyl]-2-hydroxy-2,6,9-trimethyl-4-bicyclo[8.1.0]undec-5-enyl] acetate |
| SMILES | C=C(C)[C@H](CC[C@@]1(C)CC/C(C)=C/[C@@H](OC(C)=O)C[C@](C)(O)[C@H]2C[C@@H]21)OO |
| InChI | InChI=1S/C22H36O5/c1-14(2)20(27-25)8-10-21(5)9-7-15(3)11-17(26-16(4)23)13-22(6,24)19-12-18(19)21/h11,17-20,24-25H,1,7-10,12-13H2,2-6H3/b15-11+/t17-,18+,19+,20+,21-,22+/m1/s1 |
| InChIKey | FAXDRDJWQDFFGZ-MRFVPLDXSA-N |
| XLogP | 4.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|