C14H26O — CID 7061313
(3S)-1-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]pentan-3-ol (PubChem CID 7061313) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (3S)-1-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]pentan-3-ol.
| Compound Name | (3S)-1-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]pentan-3-ol |
|---|---|
| PubChem CID | 7061313 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (3S)-1-[(1S,2R)-1,2,4-trimethylcyclohex-3-en-1-yl]pentan-3-ol |
| SMILES | CC[C@H](O)CC[C@]1(C)CCC(C)=C[C@H]1C |
| InChI | InChI=1S/C14H26O/c1-5-13(15)7-9-14(4)8-6-11(2)10-12(14)3/h10,12-13,15H,5-9H2,1-4H3/t12-,13+,14+/m1/s1 |
| InChIKey | SUQHUQJFQPNSCG-RDBSUJKOSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|