C26H38O12 — CID 163025576
[(1R,2R,3R,4R,7R,8S,9S,12R,13S,14R,17S)-2,14-diacetyloxy-3,8,9-trihydroxy-4,9,13-trimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-12-yl] acetate (PubChem CID 163025576) has the molecular formula C26H38O12 and a molecular weight of 542.58 g/mol. Its IUPAC name is [(1R,2R,3R,4R,7R,8S,9S,12R,13S,14R,17S)-2,14-diacetyloxy-3,8,9-trihydroxy-4,9,13-trimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-12-yl] acetate.
| Compound Name | [(1R,2R,3R,4R,7R,8S,9S,12R,13S,14R,17S)-2,14-diacetyloxy-3,8,9-trihydroxy-4,9,13-trimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-12-yl] acetate |
|---|---|
| PubChem CID | 163025576 |
| Molecular Formula | C26H38O12 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | [(1R,2R,3R,4R,7R,8S,9S,12R,13S,14R,17S)-2,14-diacetyloxy-3,8,9-trihydroxy-4,9,13-trimethyl-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-12-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@]3(CC[C@@H](OC(C)=O)[C@]2(C)[C@H](OC(C)=O)CC[C@](C)(O)[C@@H](O)[C@H]2OC(=O)[C@H](C)[C@@]12O)CO3 |
| InChI | InChI=1S/C26H38O12/c1-12-22(31)38-21-19(30)23(5,32)9-7-16(35-13(2)27)24(6)17(36-14(3)28)8-10-25(11-34-25)18(24)20(26(12,21)33)37-15(4)29/h12,16-21,30,32-33H,7-11H2,1-6H3/t12-,16+,17+,18-,19-,20+,21+,23-,24-,25+,26+/m0/s1 |
| InChIKey | LRIPAABNJGNVOX-HAIIDGHFSA-N |
| XLogP | 0.17 |
| TPSA | 178.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|