C22H18O8 — CID 163025839
(6R)-8,9-dihydroxy-3-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methoxy-6H-pyrano[4,3-c]isochromen-1-one (PubChem CID 163025839) has the molecular formula C22H18O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is (6R)-8,9-dihydroxy-3-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methoxy-6H-pyrano[4,3-c]isochromen-1-one.
| Compound Name | (6R)-8,9-dihydroxy-3-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methoxy-6H-pyrano[4,3-c]isochromen-1-one |
|---|---|
| PubChem CID | 163025839 |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (6R)-8,9-dihydroxy-3-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methoxy-6H-pyrano[4,3-c]isochromen-1-one |
| SMILES | COc1cc(C=Cc2cc3c(c(=O)o2)-c2cc(O)c(O)cc2[C@H](OC)O3)ccc1O |
| InChI | InChI=1S/C22H18O8/c1-27-18-7-11(4-6-15(18)23)3-5-12-8-19-20(21(26)29-12)13-9-16(24)17(25)10-14(13)22(28-2)30-19/h3-10,22-25H,1-2H3/t22-/m1/s1 |
| InChIKey | UZQPGXYTBRUVFG-JOCHJYFZSA-N |
| XLogP | 3.64 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|