C24H20O8 — CID 162944984
(2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-[(3,4-dihydroxyphenyl)methylidene]-2-methoxy-2-methylfuro[3,2-c]pyran-4-one (PubChem CID 162944984) has the molecular formula C24H20O8 and a molecular weight of 436.42 g/mol. Its IUPAC name is (2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-[(3,4-dihydroxyphenyl)methylidene]-2-methoxy-2-methylfuro[3,2-c]pyran-4-one.
| Compound Name | (2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-[(3,4-dihydroxyphenyl)methylidene]-2-methoxy-2-methylfuro[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 162944984 |
| Molecular Formula | C24H20O8 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-[(3,4-dihydroxyphenyl)methylidene]-2-methoxy-2-methylfuro[3,2-c]pyran-4-one |
| SMILES | CO[C@]1(C)Oc2cc(/C=C/c3ccc(O)c(O)c3)oc(=O)c2C1=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C24H20O8/c1-24(30-2)16(9-14-5-8-18(26)20(28)11-14)22-21(32-24)12-15(31-23(22)29)6-3-13-4-7-17(25)19(27)10-13/h3-12,25-28H,1-2H3/b6-3+,16-9?/t24-/m1/s1 |
| InChIKey | RNGFLTFOEGMRRY-WFVNIAJTSA-N |
| XLogP | 3.93 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|