C22H36O3 — CID 163026374
(2S,3E,5S)-3-[2-[(1S,2R,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-dimethoxyoxolane (PubChem CID 163026374) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2S,3E,5S)-3-[2-[(1S,2R,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-dimethoxyoxolane.
| Compound Name | (2S,3E,5S)-3-[2-[(1S,2R,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-dimethoxyoxolane |
|---|---|
| PubChem CID | 163026374 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (2S,3E,5S)-3-[2-[(1S,2R,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-dimethoxyoxolane |
| SMILES | CO[C@@H]1C/C(=C\C[C@@]2(C)[C@H](C)CC[C@]3(C)C(C)=CCC[C@@H]23)[C@@H](OC)O1 |
| InChI | InChI=1S/C22H36O3/c1-15-8-7-9-18-21(15,3)12-10-16(2)22(18,4)13-11-17-14-19(23-5)25-20(17)24-6/h8,11,16,18-20H,7,9-10,12-14H2,1-6H3/b17-11+/t16-,18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | BCNNXHSXFZXSIE-VSDSEREMSA-N |
| XLogP | 5.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|