C18H26O3 — CID 163027418
(3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl) propanoate (PubChem CID 163027418) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl) propanoate.
| Compound Name | (3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl) propanoate |
|---|---|
| PubChem CID | 163027418 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl) propanoate |
| SMILES | CCC(=O)OC1c2c(C)coc2CC2CCCC(C)C21C |
| InChI | InChI=1S/C18H26O3/c1-5-15(19)21-17-16-11(2)10-20-14(16)9-13-8-6-7-12(3)18(13,17)4/h10,12-13,17H,5-9H2,1-4H3 |
| InChIKey | SQDGWITYLAENDE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |