C25H42O6 — CID 163027627
5-[7-hydroxy-6-(2-hydroxy-2-methylbutanoyl)oxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 163027627) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is 5-[7-hydroxy-6-(2-hydroxy-2-methylbutanoyl)oxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | 5-[7-hydroxy-6-(2-hydroxy-2-methylbutanoyl)oxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163027627 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 5-[7-hydroxy-6-(2-hydroxy-2-methylbutanoyl)oxy-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)(O)C(=O)OC1C(O)CC2(C)C(CCC(C)CC(=O)O)C(C)=CCC2C1(C)C |
| InChI | InChI=1S/C25H42O6/c1-8-25(7,30)22(29)31-21-18(26)14-24(6)17(11-9-15(2)13-20(27)28)16(3)10-12-19(24)23(21,4)5/h10,15,17-19,21,26,30H,8-9,11-14H2,1-7H3,(H,27,28) |
| InChIKey | WBIMZYOREAFVMD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|