C52H58N4O7 — CID 163028589
CID 163028589 (PubChem CID 163028589) has the molecular formula C52H58N4O7 and a molecular weight of 851.06 g/mol.
| Compound Name | CID 163028589 |
|---|---|
| PubChem CID | 163028589 |
| Molecular Formula | C52H58N4O7 |
| Molecular Weight | 851.06 g/mol |
| Exact Mass | 850.43 |
| IUPAC Name | — |
| SMILES | CC1C=CC(C(O)CC(=O)CCc2cc3c(cc2O)OC#CC2(CCCC2)C2C#CC(O)c4ccc5c6c4C(c4c[nH]c7cn(cc47)C2O3)C2(CCCC2)CC6CNC5N)C(O)C1 |
| InChI | InChI=1S/C52H58N4O7/c1-29-6-9-33(42(60)20-29)43(61)22-32(57)8-7-30-21-45-44(23-41(30)59)62-19-18-51(14-2-3-15-51)38-12-13-40(58)34-10-11-35-46-31(25-55-49(35)53)24-52(16-4-5-17-52)48(47(34)46)36-26-54-39-28-56(27-37(36)39)50(38)63-45/h6,9-11,21,23,26-29,31,33,38,40,42-43,48-50,54-55,58-61H,2-5,7-8,14-17,20,22,24-25,53H2,1H3 |
| InChIKey | BEBRESPBVLYFRM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.06 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|