C20H28O6 — CID 163028913
[(3aR,4R,6R,6aR,9R,9aR,9bS)-6,9-dihydroxy-6,9-dimethyl-3-methylidene-2,8-dioxo-1,3a,4,5,6a,7,9a,9b-octahydrocyclopenta[e]azulen-4-yl] 2-methylpropanoate (PubChem CID 163028913) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR,9R,9aR,9bS)-6,9-dihydroxy-6,9-dimethyl-3-methylidene-2,8-dioxo-1,3a,4,5,6a,7,9a,9b-octahydrocyclopenta[e]azulen-4-yl] 2-methylpropanoate.
| Compound Name | [(3aR,4R,6R,6aR,9R,9aR,9bS)-6,9-dihydroxy-6,9-dimethyl-3-methylidene-2,8-dioxo-1,3a,4,5,6a,7,9a,9b-octahydrocyclopenta[e]azulen-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163028913 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(3aR,4R,6R,6aR,9R,9aR,9bS)-6,9-dihydroxy-6,9-dimethyl-3-methylidene-2,8-dioxo-1,3a,4,5,6a,7,9a,9b-octahydrocyclopenta[e]azulen-4-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)C[C@H]2[C@H]1[C@H](OC(=O)C(C)C)C[C@@](C)(O)[C@@H]1CC(=O)[C@](C)(O)[C@H]21 |
| InChI | InChI=1S/C20H28O6/c1-9(2)18(23)26-14-8-19(4,24)12-7-15(22)20(5,25)17(12)11-6-13(21)10(3)16(11)14/h9,11-12,14,16-17,24-25H,3,6-8H2,1-2,4-5H3/t11-,12+,14+,16-,17+,19+,20-/m0/s1 |
| InChIKey | VBKMYXUMSNQYAM-UPQKDRMRSA-N |
| XLogP | 1.43 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|