C20H28O7 — CID 163029508
(4E,6S,8E,10R,14S,15aS)-10-hydroperoxy-6,15a-dihydroxy-3,6,10,14-tetramethyl-11,12,13,14-tetrahydro-7H-cyclotetradeca[b]furan-2,15-dione (PubChem CID 163029508) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (4E,6S,8E,10R,14S,15aS)-10-hydroperoxy-6,15a-dihydroxy-3,6,10,14-tetramethyl-11,12,13,14-tetrahydro-7H-cyclotetradeca[b]furan-2,15-dione.
| Compound Name | (4E,6S,8E,10R,14S,15aS)-10-hydroperoxy-6,15a-dihydroxy-3,6,10,14-tetramethyl-11,12,13,14-tetrahydro-7H-cyclotetradeca[b]furan-2,15-dione |
|---|---|
| PubChem CID | 163029508 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (4E,6S,8E,10R,14S,15aS)-10-hydroperoxy-6,15a-dihydroxy-3,6,10,14-tetramethyl-11,12,13,14-tetrahydro-7H-cyclotetradeca[b]furan-2,15-dione |
| SMILES | CC1=C2/C=C/[C@@](C)(O)C/C=C/[C@](C)(OO)CCC[C@H](C)C(=O)[C@@]2(O)OC1=O |
| InChI | InChI=1S/C20H28O7/c1-13-7-5-10-19(4,27-25)11-6-9-18(3,23)12-8-15-14(2)17(22)26-20(15,24)16(13)21/h6,8,11-13,23-25H,5,7,9-10H2,1-4H3/b11-6+,12-8+/t13-,18-,19+,20-/m0/s1 |
| InChIKey | QTKBFSVJJYCYJS-MIKMDMPBSA-N |
| XLogP | 2.44 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|