C23H32O4 — CID 54740245
(1S,3S,6S,10R,12R,13E,15Z)-15-hydroxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,15-triene-17,19-dione (PubChem CID 54740245) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1S,3S,6S,10R,12R,13E,15Z)-15-hydroxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,15-triene-17,19-dione.
| Compound Name | (1S,3S,6S,10R,12R,13E,15Z)-15-hydroxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,15-triene-17,19-dione |
|---|---|
| PubChem CID | 54740245 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1S,3S,6S,10R,12R,13E,15Z)-15-hydroxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,15-triene-17,19-dione |
| SMILES | CC1=C[C@@H]2CCC[C@@H](C)C[C@@H](C)/C=C(C)/C(O)=C3\C(=O)O[C@]2(C[C@@H]1C)C3=O |
| InChI | InChI=1S/C23H32O4/c1-13-7-6-8-18-11-15(3)17(5)12-23(18)21(25)19(22(26)27-23)20(24)16(4)10-14(2)9-13/h10-11,13-14,17-18,24H,6-9,12H2,1-5H3/b16-10+,20-19+/t13-,14-,17+,18+,23+/m1/s1 |
| InChIKey | GNFFKZIDPGAGMZ-FDAGHSCQSA-N |
| XLogP | 5.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|