C20H24O5 — CID 134840437
(2Z,5S,11S,12S)-1-hydroxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-triene-7,13-dione (PubChem CID 134840437) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2Z,5S,11S,12S)-1-hydroxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-triene-7,13-dione.
| Compound Name | (2Z,5S,11S,12S)-1-hydroxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-triene-7,13-dione |
|---|---|
| PubChem CID | 134840437 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2Z,5S,11S,12S)-1-hydroxy-3,14-dimethyl-11-prop-1-en-2-yl-6,16-dioxatricyclo[10.3.1.15,8]heptadeca-2,8(17),14-triene-7,13-dione |
| SMILES | C=C(C)[C@@H]1CCC2=C[C@H](C/C(C)=C\C3(O)C=C(C)C(=O)[C@H]1O3)OC2=O |
| InChI | InChI=1S/C20H24O5/c1-11(2)16-6-5-14-8-15(24-19(14)22)7-12(3)9-20(23)10-13(4)17(21)18(16)25-20/h8-10,15-16,18,23H,1,5-7H2,2-4H3/b12-9-/t15-,16-,18-,20?/m0/s1 |
| InChIKey | LDKFUDWSGVEQCV-ZZTLXGLGSA-N |
| XLogP | 2.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|