C20H32O4 — CID 163034904
3-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-7-hydroxydioxepane-5-carbaldehyde (PubChem CID 163034904) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 3-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-7-hydroxydioxepane-5-carbaldehyde.
| Compound Name | 3-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-7-hydroxydioxepane-5-carbaldehyde |
|---|---|
| PubChem CID | 163034904 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-(5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-7-hydroxydioxepane-5-carbaldehyde |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1C1CC(C=O)CC(O)OO1 |
| InChI | InChI=1S/C20H32O4/c1-13-6-7-16-19(2,3)8-5-9-20(16,4)18(13)15-10-14(12-21)11-17(22)24-23-15/h12,14-18,22H,1,5-11H2,2-4H3 |
| InChIKey | VUWOGLPICKGRDI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|