C20H26O6 — CID 163036195
(1S,4S,8S,12R)-9-[2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-9-ene-3,11-dione (PubChem CID 163036195) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1S,4S,8S,12R)-9-[2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-9-ene-3,11-dione.
| Compound Name | (1S,4S,8S,12R)-9-[2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-9-ene-3,11-dione |
|---|---|
| PubChem CID | 163036195 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1S,4S,8S,12R)-9-[2-[(3S)-3-hydroxy-5-oxooxolan-3-yl]ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodec-9-ene-3,11-dione |
| SMILES | CC1=C(CC[C@@]2(O)COC(=O)C2)[C@@]2(C)CCC[C@]3(C)C(=O)O[C@H](C1=O)[C@@H]32 |
| InChI | InChI=1S/C20H26O6/c1-11-12(5-8-20(24)9-13(21)25-10-20)18(2)6-4-7-19(3)16(18)15(14(11)22)26-17(19)23/h15-16,24H,4-10H2,1-3H3/t15-,16-,18-,19+,20+/m1/s1 |
| InChIKey | JRBMIKVAUKDRCI-ZJXIFLPPSA-N |
| XLogP | 2.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |