C20H40 — CID 163036615
(3R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene (PubChem CID 163036615) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is (3R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene.
| Compound Name | (3R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene |
|---|---|
| PubChem CID | 163036615 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | (3R,7S,11S)-3,7,11,15-tetramethylhexadec-1-ene |
| SMILES | C=C[C@H](C)CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H40/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,17-20H,1,8-16H2,2-6H3/t18-,19-,20+/m0/s1 |
| InChIKey | XQNRAQZFPXUCOT-SLFFLAALSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|