C23H20N2O2 — CID 163037453
2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-3-[(4-hydroxyphenyl)methylidene]butanedinitrile (PubChem CID 163037453) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-3-[(4-hydroxyphenyl)methylidene]butanedinitrile.
| Compound Name | 2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-3-[(4-hydroxyphenyl)methylidene]butanedinitrile |
|---|---|
| PubChem CID | 163037453 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methylidene]-3-[(4-hydroxyphenyl)methylidene]butanedinitrile |
| SMILES | CC1(C)CCc2cc(C=C(C#N)C(C#N)=Cc3ccc(O)cc3)ccc2O1 |
| InChI | InChI=1S/C23H20N2O2/c1-23(2)10-9-18-12-17(5-8-22(18)27-23)13-20(15-25)19(14-24)11-16-3-6-21(26)7-4-16/h3-8,11-13,26H,9-10H2,1-2H3 |
| InChIKey | RTNSFMANFMBMKP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|