C27H38O13 — CID 163041097
[(2R,3S,4S,5R,6R)-6-[(1R,3R,4R)-3,4-dihydroxy-2,2,5,5-tetramethyl-3-(3-methylbut-2-enoyl)cyclopentyl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 163041097) has the molecular formula C27H38O13 and a molecular weight of 570.59 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(1R,3R,4R)-3,4-dihydroxy-2,2,5,5-tetramethyl-3-(3-methylbut-2-enoyl)cyclopentyl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(1R,3R,4R)-3,4-dihydroxy-2,2,5,5-tetramethyl-3-(3-methylbut-2-enoyl)cyclopentyl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 163041097 |
| Molecular Formula | C27H38O13 |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(1R,3R,4R)-3,4-dihydroxy-2,2,5,5-tetramethyl-3-(3-methylbut-2-enoyl)cyclopentyl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | CC(C)=CC(=O)[C@]1(O)[C@H](O)C(C)(C)[C@@H](O[C@@H]2O[C@H](COC(=O)c3cc(O)c(O)c(O)c3)[C@@H](O)[C@H](O)[C@H]2O)C1(C)C |
| InChI | InChI=1S/C27H38O13/c1-11(2)7-16(30)27(37)23(36)25(3,4)24(26(27,5)6)40-22-20(34)19(33)18(32)15(39-22)10-38-21(35)12-8-13(28)17(31)14(29)9-12/h7-9,15,18-20,22-24,28-29,31-34,36-37H,10H2,1-6H3/t15-,18-,19+,20-,22+,23-,24-,27+/m1/s1 |
| InChIKey | AIPCPUCSLAEJDF-HPDGUDNBSA-N |
| XLogP | -0.15 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|