C27H38O14 — CID 125416108
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(1R,2S)-2-hydroxy-2-(2-hydroxy-2-methylpropyl)-4,4,6,6-tetramethyl-3,5-dioxocyclohexyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate (PubChem CID 125416108) has the molecular formula C27H38O14 and a molecular weight of 586.59 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(1R,2S)-2-hydroxy-2-(2-hydroxy-2-methylpropyl)-4,4,6,6-tetramethyl-3,5-dioxocyclohexyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(1R,2S)-2-hydroxy-2-(2-hydroxy-2-methylpropyl)-4,4,6,6-tetramethyl-3,5-dioxocyclohexyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 125416108 |
| Molecular Formula | C27H38O14 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(1R,2S)-2-hydroxy-2-(2-hydroxy-2-methylpropyl)-4,4,6,6-tetramethyl-3,5-dioxocyclohexyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES | CC(C)(O)C[C@@]1(O)C(=O)C(C)(C)C(=O)C(C)(C)[C@H]1O[C@@H]1O[C@H](COC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H38O14/c1-24(2,37)10-27(38)22(36)25(3,4)21(35)26(5,6)23(27)41-20-18(33)17(32)16(31)14(40-20)9-39-19(34)11-7-12(28)15(30)13(29)8-11/h7-8,14,16-18,20,23,28-33,37-38H,9-10H2,1-6H3/t14-,16-,17+,18-,20+,23-,27-/m1/s1 |
| InChIKey | SFGFJHKABNCWLY-UHHLUPFPSA-N |
| XLogP | -0.75 |
| TPSA | 240.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|