C37H48O12 — CID 163042481
5,7-dimethoxy-8-[2,3,5-trihydroxy-6-(3-hydroxy-2,2,3-trimethylbutoxy)-7-(7-methoxy-2-oxochromen-8-yl)-3,5-dimethylheptyl]chromen-2-one (PubChem CID 163042481) has the molecular formula C37H48O12 and a molecular weight of 684.78 g/mol. Its IUPAC name is 5,7-dimethoxy-8-[2,3,5-trihydroxy-6-(3-hydroxy-2,2,3-trimethylbutoxy)-7-(7-methoxy-2-oxochromen-8-yl)-3,5-dimethylheptyl]chromen-2-one.
| Compound Name | 5,7-dimethoxy-8-[2,3,5-trihydroxy-6-(3-hydroxy-2,2,3-trimethylbutoxy)-7-(7-methoxy-2-oxochromen-8-yl)-3,5-dimethylheptyl]chromen-2-one |
|---|---|
| PubChem CID | 163042481 |
| Molecular Formula | C37H48O12 |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | 5,7-dimethoxy-8-[2,3,5-trihydroxy-6-(3-hydroxy-2,2,3-trimethylbutoxy)-7-(7-methoxy-2-oxochromen-8-yl)-3,5-dimethylheptyl]chromen-2-one |
| SMILES | COc1ccc2ccc(=O)oc2c1CC(OCC(C)(C)C(C)(C)O)C(C)(O)CC(C)(O)C(O)Cc1c(OC)cc(OC)c2ccc(=O)oc12 |
| InChI | InChI=1S/C37H48O12/c1-34(2,35(3,4)41)20-47-29(17-24-25(44-7)13-10-21-11-14-30(39)48-32(21)24)37(6,43)19-36(5,42)28(38)16-23-27(46-9)18-26(45-8)22-12-15-31(40)49-33(22)23/h10-15,18,28-29,38,41-43H,16-17,19-20H2,1-9H3 |
| InChIKey | YZLBEVMSWOPZDJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|