C16H20O6 — CID 163039145
8-[(3S)-4-hydroxy-3-methylbutoxy]-5,7-dimethoxychromen-2-one (PubChem CID 163039145) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is 8-[(3S)-4-hydroxy-3-methylbutoxy]-5,7-dimethoxychromen-2-one.
| Compound Name | 8-[(3S)-4-hydroxy-3-methylbutoxy]-5,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 163039145 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 8-[(3S)-4-hydroxy-3-methylbutoxy]-5,7-dimethoxychromen-2-one |
| SMILES | COc1cc(OC)c2ccc(=O)oc2c1OCC[C@H](C)CO |
| InChI | InChI=1S/C16H20O6/c1-10(9-17)6-7-21-16-13(20-3)8-12(19-2)11-4-5-14(18)22-15(11)16/h4-5,8,10,17H,6-7,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | SGGDZIIGURPMAE-JTQLQIEISA-N |
| XLogP | 2.21 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|