C29H34O10 — CID 163043903
[(1R,3S,7R,16S,17R,20Z,23Z)-10,16-dimethyl-4,19-dioxospiro[2,5,13,18,25-pentaoxahexacyclo[22.3.1.114,17.01,3.07,12.07,16]nonacosa-10,20,23-triene-15,2'-oxirane]-28-yl] acetate (PubChem CID 163043903) has the molecular formula C29H34O10 and a molecular weight of 542.58 g/mol. Its IUPAC name is [(1R,3S,7R,16S,17R,20Z,23Z)-10,16-dimethyl-4,19-dioxospiro[2,5,13,18,25-pentaoxahexacyclo[22.3.1.114,17.01,3.07,12.07,16]nonacosa-10,20,23-triene-15,2'-oxirane]-28-yl] acetate.
| Compound Name | [(1R,3S,7R,16S,17R,20Z,23Z)-10,16-dimethyl-4,19-dioxospiro[2,5,13,18,25-pentaoxahexacyclo[22.3.1.114,17.01,3.07,12.07,16]nonacosa-10,20,23-triene-15,2'-oxirane]-28-yl] acetate |
|---|---|
| PubChem CID | 163043903 |
| Molecular Formula | C29H34O10 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [(1R,3S,7R,16S,17R,20Z,23Z)-10,16-dimethyl-4,19-dioxospiro[2,5,13,18,25-pentaoxahexacyclo[22.3.1.114,17.01,3.07,12.07,16]nonacosa-10,20,23-triene-15,2'-oxirane]-28-yl] acetate |
| SMILES | CC(=O)OC1/C2=C\C/C=C\C(=O)O[C@@H]3CC4OC5C=C(C)CC[C@]5(COC(=O)[C@H]5O[C@]15CCO2)[C@]3(C)C41CO1 |
| InChI | InChI=1S/C29H34O10/c1-16-8-9-27-14-34-25(32)24-28(39-24)10-11-33-18(23(28)36-17(2)30)6-4-5-7-22(31)38-19-13-21(37-20(27)12-16)29(15-35-29)26(19,27)3/h5-7,12,19-21,23-24H,4,8-11,13-15H2,1-3H3/b7-5-,18-6+/t19-,20?,21?,23?,24-,26-,27-,28-,29?/m1/s1 |
| InChIKey | BMCNUWAOQXQLPE-LFLUIGJASA-N |
| XLogP | 2.45 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|