C24H34O5 — CID 163044235
7-[[(1R,2S,4aR,6S,8aS)-1,6-dihydroxy-1,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-2-yl]methoxy]-3,4-dihydrochromen-2-one (PubChem CID 163044235) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is 7-[[(1R,2S,4aR,6S,8aS)-1,6-dihydroxy-1,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-2-yl]methoxy]-3,4-dihydrochromen-2-one.
| Compound Name | 7-[[(1R,2S,4aR,6S,8aS)-1,6-dihydroxy-1,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-2-yl]methoxy]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 163044235 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 7-[[(1R,2S,4aR,6S,8aS)-1,6-dihydroxy-1,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-2-yl]methoxy]-3,4-dihydrochromen-2-one |
| SMILES | CC1(C)[C@H]2CC[C@@H](COc3ccc4c(c3)OC(=O)CC4)[C@@](C)(O)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C24H34O5/c1-22(2)19-9-7-16(24(4,27)23(19,3)12-11-20(22)25)14-28-17-8-5-15-6-10-21(26)29-18(15)13-17/h5,8,13,16,19-20,25,27H,6-7,9-12,14H2,1-4H3/t16-,19+,20-,23-,24+/m0/s1 |
| InChIKey | LMBYKBUOKRNKSI-RPZPBAIQSA-N |
| XLogP | 3.88 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|