C21H22O6 — CID 163044482
[(1R)-1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-2,2-dimethylcyclobutyl] 2-methylbut-2-enoate (PubChem CID 163044482) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(1R)-1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-2,2-dimethylcyclobutyl] 2-methylbut-2-enoate.
| Compound Name | [(1R)-1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-2,2-dimethylcyclobutyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163044482 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(1R)-1-(1,4-dihydroxy-5,8-dioxonaphthalen-2-yl)-2,2-dimethylcyclobutyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@]1(c2cc(O)c3c(c2O)C(=O)C=CC3=O)CCC1(C)C |
| InChI | InChI=1S/C21H22O6/c1-5-11(2)19(26)27-21(9-8-20(21,3)4)12-10-15(24)16-13(22)6-7-14(23)17(16)18(12)25/h5-7,10,24-25H,8-9H2,1-4H3/t21-/m0/s1 |
| InChIKey | LHIVOYFZCXVDIY-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|