C16H25BrO2 — CID 163044794
[(2S)-2-[[(1R,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]methyl]but-3-enyl] acetate (PubChem CID 163044794) has the molecular formula C16H25BrO2 and a molecular weight of 329.28 g/mol. Its IUPAC name is [(2S)-2-[[(1R,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]methyl]but-3-enyl] acetate.
| Compound Name | [(2S)-2-[[(1R,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]methyl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 163044794 |
| Molecular Formula | C16H25BrO2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [(2S)-2-[[(1R,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]methyl]but-3-enyl] acetate |
| SMILES | C=C[C@@H](COC(C)=O)C[C@@H]1C(=C)CC[C@@H](Br)C1(C)C |
| InChI | InChI=1S/C16H25BrO2/c1-6-13(10-19-12(3)18)9-14-11(2)7-8-15(17)16(14,4)5/h6,13-15H,1-2,7-10H2,3-5H3/t13-,14-,15-/m1/s1 |
| InChIKey | AGXPZYPVDGCMPE-RBSFLKMASA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|