C19H20O5 — CID 163045020
[(1R,5R,9R,16R)-5,9-dimethyl-2,4-dioxo-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-trien-1-yl] acetate (PubChem CID 163045020) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(1R,5R,9R,16R)-5,9-dimethyl-2,4-dioxo-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-trien-1-yl] acetate.
| Compound Name | [(1R,5R,9R,16R)-5,9-dimethyl-2,4-dioxo-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-trien-1-yl] acetate |
|---|---|
| PubChem CID | 163045020 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(1R,5R,9R,16R)-5,9-dimethyl-2,4-dioxo-3-oxatetracyclo[7.6.1.05,16.010,15]hexadeca-10,12,14-trien-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12C(=O)OC(=O)[C@]3(C)CCC[C@@](C)(c4ccccc41)[C@H]32 |
| InChI | InChI=1S/C19H20O5/c1-11(20)24-19-13-8-5-4-7-12(13)17(2)9-6-10-18(3,14(17)19)15(21)23-16(19)22/h4-5,7-8,14H,6,9-10H2,1-3H3/t14-,17+,18-,19+/m1/s1 |
| InChIKey | NYUIETATSKBTCZ-FDPIWHGQSA-N |
| XLogP | 2.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|