C14H14O3 — CID 11806460
(4-oxo-1,2,3,8b-tetrahydrobiphenylen-4a-yl) acetate (PubChem CID 11806460) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (4-oxo-1,2,3,8b-tetrahydrobiphenylen-4a-yl) acetate.
| Compound Name | (4-oxo-1,2,3,8b-tetrahydrobiphenylen-4a-yl) acetate |
|---|---|
| PubChem CID | 11806460 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (4-oxo-1,2,3,8b-tetrahydrobiphenylen-4a-yl) acetate |
| SMILES | CC(=O)OC12C(=O)CCCC1c1ccccc12 |
| InChI | InChI=1S/C14H14O3/c1-9(15)17-14-11-6-3-2-5-10(11)12(14)7-4-8-13(14)16/h2-3,5-6,12H,4,7-8H2,1H3 |
| InChIKey | XQUOKJVYFBBWLC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |