C16H24O4 — CID 163046940
2,7-dihydroxy-2,8,10b-trimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-1-one (PubChem CID 163046940) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2,7-dihydroxy-2,8,10b-trimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-1-one.
| Compound Name | 2,7-dihydroxy-2,8,10b-trimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-1-one |
|---|---|
| PubChem CID | 163046940 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2,7-dihydroxy-2,8,10b-trimethyl-4,4a,6a,7,8,9,10,10a-octahydrobenzo[f]isochromen-1-one |
| SMILES | CC1CCC2C(C=CC3COC(C)(O)C(=O)C32C)C1O |
| InChI | InChI=1S/C16H24O4/c1-9-4-7-12-11(13(9)17)6-5-10-8-20-16(3,19)14(18)15(10,12)2/h5-6,9-13,17,19H,4,7-8H2,1-3H3 |
| InChIKey | ZVEYAIMRDBXWPO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|