C39H62O9 — CID 163047790
[4,6-diacetyloxy-5,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] pentanoate (PubChem CID 163047790) has the molecular formula C39H62O9 and a molecular weight of 674.92 g/mol. Its IUPAC name is [4,6-diacetyloxy-5,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] pentanoate.
| Compound Name | [4,6-diacetyloxy-5,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] pentanoate |
|---|---|
| PubChem CID | 163047790 |
| Molecular Formula | C39H62O9 |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.44 |
| IUPAC Name | [4,6-diacetyloxy-5,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] pentanoate |
| SMILES | CCCCC(=O)OC1C(OC(C)=O)C2(CO)C(CC1(C)C)C1=CCC3C4(C)CCC(O)C(C)(C)C4CCC3(C)C1(C)C(OC(C)=O)C2O |
| InChI | InChI=1S/C39H62O9/c1-11-12-13-29(44)48-32-33(47-23(3)42)39(21-40)25(20-34(32,4)5)24-14-15-27-36(8)18-17-28(43)35(6,7)26(36)16-19-37(27,9)38(24,10)31(30(39)45)46-22(2)41/h14,25-28,30-33,40,43,45H,11-13,15-21H2,1-10H3 |
| InChIKey | NUXXFHJONQEWQE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|