C37H58O8 — CID 162959617
[4-acetyloxy-5,6,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 3-methylbut-2-enoate (PubChem CID 162959617) has the molecular formula C37H58O8 and a molecular weight of 630.86 g/mol. Its IUPAC name is [4-acetyloxy-5,6,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 3-methylbut-2-enoate.
| Compound Name | [4-acetyloxy-5,6,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 162959617 |
| Molecular Formula | C37H58O8 |
| Molecular Weight | 630.86 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | [4-acetyloxy-5,6,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 3-methylbut-2-enoate |
| SMILES | CC(=O)OC1C(OC(=O)C=C(C)C)C(C)(C)CC2C3=CCC4C5(C)CCC(O)C(C)(C)C5CCC4(C)C3(C)C(O)C(O)C21CO |
| InChI | InChI=1S/C37H58O8/c1-20(2)17-27(41)45-30-31(44-21(3)39)37(19-38)23(18-32(30,4)5)22-11-12-25-34(8)15-14-26(40)33(6,7)24(34)13-16-35(25,9)36(22,10)28(42)29(37)43/h11,17,23-26,28-31,38,40,42-43H,12-16,18-19H2,1-10H3 |
| InChIKey | MINJOBIRAGISHW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.86 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|