C34H54O8 — CID 163339362
[(4aS,6aS,6bR,12aR)-6-acetyloxy-4,5,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] acetate (PubChem CID 163339362) has the molecular formula C34H54O8 and a molecular weight of 590.80 g/mol. Its IUPAC name is [(4aS,6aS,6bR,12aR)-6-acetyloxy-4,5,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(4aS,6aS,6bR,12aR)-6-acetyloxy-4,5,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 163339362 |
| Molecular Formula | C34H54O8 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | [(4aS,6aS,6bR,12aR)-6-acetyloxy-4,5,10-trihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)OC1C(O)[C@@]2(CO)C(CC1(C)C)C1=CCC3[C@@]4(C)CCC(O)C(C)(C)C4CC[C@@]3(C)[C@]1(C)C(OC(C)=O)C2O |
| InChI | InChI=1S/C34H54O8/c1-18(36)41-27-25(39)34(17-35)21(16-29(27,3)4)20-10-11-23-31(7)14-13-24(38)30(5,6)22(31)12-15-32(23,8)33(20,9)28(26(34)40)42-19(2)37/h10,21-28,35,38-40H,11-17H2,1-9H3/t21?,22?,23?,24?,25?,26?,27?,28?,31-,32+,33-,34+/m0/s1 |
| InChIKey | PBCUPVVZMHBBAY-HQSVBMSVSA-N |
| XLogP | 4.17 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|