C39H62O10 — CID 163059299
[4a-(acetyloxymethyl)-4,5,6,10-tetrahydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 2-acetyloxy-2-methylbutanoate (PubChem CID 163059299) has the molecular formula C39H62O10 and a molecular weight of 690.91 g/mol. Its IUPAC name is [4a-(acetyloxymethyl)-4,5,6,10-tetrahydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 2-acetyloxy-2-methylbutanoate.
| Compound Name | [4a-(acetyloxymethyl)-4,5,6,10-tetrahydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 2-acetyloxy-2-methylbutanoate |
|---|---|
| PubChem CID | 163059299 |
| Molecular Formula | C39H62O10 |
| Molecular Weight | 690.91 g/mol |
| Exact Mass | 690.43 |
| IUPAC Name | [4a-(acetyloxymethyl)-4,5,6,10-tetrahydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] 2-acetyloxy-2-methylbutanoate |
| SMILES | CCC(C)(OC(C)=O)C(=O)OC1C(O)C2(COC(C)=O)C(CC1(C)C)C1=CCC3C4(C)CCC(O)C(C)(C)C4CCC3(C)C1(C)C(O)C2O |
| InChI | InChI=1S/C39H62O10/c1-12-37(10,49-22(3)41)32(46)48-31-30(45)39(20-47-21(2)40)24(19-33(31,4)5)23-13-14-26-35(8)17-16-27(42)34(6,7)25(35)15-18-36(26,9)38(23,11)28(43)29(39)44/h13,24-31,42-45H,12,14-20H2,1-11H3 |
| InChIKey | JKARZEGRKJTRPH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|