C35H56O5 — CID 163074445
[4,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-5-yl] 3-methylbut-2-enoate (PubChem CID 163074445) has the molecular formula C35H56O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is [4,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-5-yl] 3-methylbut-2-enoate.
| Compound Name | [4,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-5-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 163074445 |
| Molecular Formula | C35H56O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | [4,10-dihydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-5-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC1CC2(C)C(=CCC3C4(C)CCC(O)C(C)(C)C4CCC32C)C2CC(C)(C)CC(O)C12CO |
| InChI | InChI=1S/C35H56O5/c1-21(2)16-29(39)40-28-19-34(9)22(23-17-30(3,4)18-27(38)35(23,28)20-36)10-11-25-32(7)14-13-26(37)31(5,6)24(32)12-15-33(25,34)8/h10,16,23-28,36-38H,11-15,17-20H2,1-9H3 |
| InChIKey | PZYQHGGPBRZGCH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|