C21H32ClNO2 — CID 163051090
N-[(1R,4R,8aR)-4-[2-(2-chloropropan-2-yl)-3,6-dihydro-2H-pyran-5-yl]-1,6-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]formamide (PubChem CID 163051090) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is N-[(1R,4R,8aR)-4-[2-(2-chloropropan-2-yl)-3,6-dihydro-2H-pyran-5-yl]-1,6-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]formamide.
| Compound Name | N-[(1R,4R,8aR)-4-[2-(2-chloropropan-2-yl)-3,6-dihydro-2H-pyran-5-yl]-1,6-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]formamide |
|---|---|
| PubChem CID | 163051090 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(1R,4R,8aR)-4-[2-(2-chloropropan-2-yl)-3,6-dihydro-2H-pyran-5-yl]-1,6-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-yl]formamide |
| SMILES | CC1=CC2[C@@H](CC1)[C@](C)(NC=O)CC[C@H]2C1=CCC(C(C)(C)Cl)OC1 |
| InChI | InChI=1S/C21H32ClNO2/c1-14-5-7-18-17(11-14)16(9-10-21(18,4)23-13-24)15-6-8-19(25-12-15)20(2,3)22/h6,11,13,16-19H,5,7-10,12H2,1-4H3,(H,23,24)/t16-,17?,18+,19?,21+/m0/s1 |
| InChIKey | SQQXPBJEMWEBJP-JHQBXFDQSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|