C22H34N2O2 — CID 15818237
N-[2-[(2R,5S)-5-[(1R,4R,4aS,8aR)-4-isocyano-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl]formamide (PubChem CID 15818237) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[2-[(2R,5S)-5-[(1R,4R,4aS,8aR)-4-isocyano-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl]formamide.
| Compound Name | N-[2-[(2R,5S)-5-[(1R,4R,4aS,8aR)-4-isocyano-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl]formamide |
|---|---|
| PubChem CID | 15818237 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-[2-[(2R,5S)-5-[(1R,4R,4aS,8aR)-4-isocyano-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl]formamide |
| SMILES | [C-]#[N+][C@]1(C)CC[C@@H]([C@]2(C)CC[C@H](C(C)(C)NC=O)O2)[C@@H]2C=C(C)CC[C@@H]21 |
| InChI | InChI=1S/C22H34N2O2/c1-15-7-8-17-16(13-15)18(9-11-21(17,4)23-6)22(5)12-10-19(26-22)20(2,3)24-14-25/h13-14,16-19H,7-12H2,1-5H3,(H,24,25)/t16-,17+,18-,19-,21-,22+/m1/s1 |
| InChIKey | GBTPTPUHMWBISR-NBIPDHRESA-N |
| XLogP | 4.51 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|