C22H41ClN2O2 — CID 163119785
1-chloro-2,5-dimethyl-5-(methylamino)-8-[2-methyl-5-[2-(methylamino)propan-2-yl]oxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 163119785) has the molecular formula C22H41ClN2O2 and a molecular weight of 401.04 g/mol. Its IUPAC name is 1-chloro-2,5-dimethyl-5-(methylamino)-8-[2-methyl-5-[2-(methylamino)propan-2-yl]oxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | 1-chloro-2,5-dimethyl-5-(methylamino)-8-[2-methyl-5-[2-(methylamino)propan-2-yl]oxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163119785 |
| Molecular Formula | C22H41ClN2O2 |
| Molecular Weight | 401.04 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 1-chloro-2,5-dimethyl-5-(methylamino)-8-[2-methyl-5-[2-(methylamino)propan-2-yl]oxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | CNC(C)(C)C1CCC(C)(C2CCC(C)(NC)C3CCC(C)(O)C(Cl)C32)O1 |
| InChI | InChI=1S/C22H41ClN2O2/c1-19(2,24-6)16-10-13-22(5,27-16)15-8-11-20(3,25-7)14-9-12-21(4,26)18(23)17(14)15/h14-18,24-26H,8-13H2,1-7H3 |
| InChIKey | BCMWNJKZCOJCHP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|