C27H43ClN2O4S — CID 66560335
N-[(1S,4S,4aS,5R,6R,8aS)-5-amino-4-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-6-hydroxy-1,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]-4-methylbenzenesulfonamide (PubChem CID 66560335) has the molecular formula C27H43ClN2O4S and a molecular weight of 527.17 g/mol. Its IUPAC name is N-[(1S,4S,4aS,5R,6R,8aS)-5-amino-4-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-6-hydroxy-1,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,4S,4aS,5R,6R,8aS)-5-amino-4-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-6-hydroxy-1,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66560335 |
| Molecular Formula | C27H43ClN2O4S |
| Molecular Weight | 527.17 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | N-[(1S,4S,4aS,5R,6R,8aS)-5-amino-4-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-6-hydroxy-1,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@]2(C)CC[C@H]([C@@]3(C)CC[C@H](Cl)C(C)(C)O3)[C@H]3[C@@H](N)[C@](C)(O)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C27H43ClN2O4S/c1-17-7-9-18(10-8-17)35(32,33)30-25(4)14-11-20(22-19(25)12-15-26(5,31)23(22)29)27(6)16-13-21(28)24(2,3)34-27/h7-10,19-23,30-31H,11-16,29H2,1-6H3/t19-,20-,21-,22-,23+,25-,26+,27+/m0/s1 |
| InChIKey | NMTSPLNZYWUHAU-ASJITBHQSA-N |
| XLogP | 4.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|