C22H35N2O2S- — CID 163119265
2-[(2S,5R)-5-[(1S,4aS,7R,8R,8aS)-7-hydroxy-8-isothiocyanato-7-methyl-4-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methylazanide (PubChem CID 163119265) has the molecular formula C22H35N2O2S- and a molecular weight of 391.60 g/mol. Its IUPAC name is 2-[(2S,5R)-5-[(1S,4aS,7R,8R,8aS)-7-hydroxy-8-isothiocyanato-7-methyl-4-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methylazanide.
| Compound Name | 2-[(2S,5R)-5-[(1S,4aS,7R,8R,8aS)-7-hydroxy-8-isothiocyanato-7-methyl-4-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methylazanide |
|---|---|
| PubChem CID | 163119265 |
| Molecular Formula | C22H35N2O2S- |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2-[(2S,5R)-5-[(1S,4aS,7R,8R,8aS)-7-hydroxy-8-isothiocyanato-7-methyl-4-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalen-1-yl]-5-methyloxolan-2-yl]propan-2-yl-methylazanide |
| SMILES | C=C1CC[C@H]([C@@]2(C)CC[C@@H](C(C)(C)[N-]C)O2)[C@@H]2[C@@H]1CC[C@@](C)(O)[C@@H]2N=C=S |
| InChI | InChI=1S/C22H35N2O2S/c1-14-7-8-16(22(5)12-10-17(26-22)20(2,3)23-6)18-15(14)9-11-21(4,25)19(18)24-13-27/h15-19,25H,1,7-12H2,2-6H3/q-1/t15-,16+,17+,18+,19-,21-,22-/m1/s1 |
| InChIKey | GIMGHYKUZUMTGZ-YHTKHXHBSA-N |
| XLogP | 4.92 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|