C22H34N2O3S — CID 163034813
N-[(1S,4S,4aR,8aS)-4a-hydroxy-4-[(2R,5S)-5-(2-isothiocyanatopropan-2-yl)-2-methyloxolan-2-yl]-1,6-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]formamide (PubChem CID 163034813) has the molecular formula C22H34N2O3S and a molecular weight of 406.59 g/mol. Its IUPAC name is N-[(1S,4S,4aR,8aS)-4a-hydroxy-4-[(2R,5S)-5-(2-isothiocyanatopropan-2-yl)-2-methyloxolan-2-yl]-1,6-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]formamide.
| Compound Name | N-[(1S,4S,4aR,8aS)-4a-hydroxy-4-[(2R,5S)-5-(2-isothiocyanatopropan-2-yl)-2-methyloxolan-2-yl]-1,6-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]formamide |
|---|---|
| PubChem CID | 163034813 |
| Molecular Formula | C22H34N2O3S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[(1S,4S,4aR,8aS)-4a-hydroxy-4-[(2R,5S)-5-(2-isothiocyanatopropan-2-yl)-2-methyloxolan-2-yl]-1,6-dimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]formamide |
| SMILES | CC1=C[C@@]2(O)[C@@H](CC1)[C@@](C)(NC=O)CC[C@@H]2[C@@]1(C)CC[C@@H](C(C)(C)N=C=S)O1 |
| InChI | InChI=1S/C22H34N2O3S/c1-15-6-7-16-20(4,23-13-25)10-8-17(22(16,26)12-15)21(5)11-9-18(27-21)19(2,3)24-14-28/h12-13,16-18,26H,6-11H2,1-5H3,(H,23,25)/t16-,17+,18-,20-,21+,22+/m0/s1 |
| InChIKey | IDWJAJISNRTBQV-JPKYEYPISA-N |
| XLogP | 3.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|