C15H26O3 — CID 163051135
(3E)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylhepta-3,6-diene-1,2-diol (PubChem CID 163051135) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3E)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylhepta-3,6-diene-1,2-diol.
| Compound Name | (3E)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylhepta-3,6-diene-1,2-diol |
|---|---|
| PubChem CID | 163051135 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3E)-6-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-2-methylhepta-3,6-diene-1,2-diol |
| SMILES | C=C(C/C=C/C(C)(O)CO)[C@@H]1CC[C@@](C)(O)[C@H]1C |
| InChI | InChI=1S/C15H26O3/c1-11(6-5-8-14(3,17)10-16)13-7-9-15(4,18)12(13)2/h5,8,12-13,16-18H,1,6-7,9-10H2,2-4H3/b8-5+/t12-,13-,14?,15+/m0/s1 |
| InChIKey | QNAGPKUENISHSS-ZVFSDUFYSA-N |
| XLogP | 2.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|