C20H26N2O3S — CID 163051847
methyl 5-methoxy-4-methyl-7-[2-(2-propan-2-yl-1,3-thiazol-4-yl)-3H-pyrrol-5-yl]hepta-2,6-dienoate (PubChem CID 163051847) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is methyl 5-methoxy-4-methyl-7-[2-(2-propan-2-yl-1,3-thiazol-4-yl)-3H-pyrrol-5-yl]hepta-2,6-dienoate.
| Compound Name | methyl 5-methoxy-4-methyl-7-[2-(2-propan-2-yl-1,3-thiazol-4-yl)-3H-pyrrol-5-yl]hepta-2,6-dienoate |
|---|---|
| PubChem CID | 163051847 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl 5-methoxy-4-methyl-7-[2-(2-propan-2-yl-1,3-thiazol-4-yl)-3H-pyrrol-5-yl]hepta-2,6-dienoate |
| SMILES | COC(=O)C=CC(C)C(C=CC1=CCC(c2csc(C(C)C)n2)=N1)OC |
| InChI | InChI=1S/C20H26N2O3S/c1-13(2)20-22-17(12-26-20)16-9-7-15(21-16)8-10-18(24-4)14(3)6-11-19(23)25-5/h6-8,10-14,18H,9H2,1-5H3 |
| InChIKey | GGTIUQUCNXPFEF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|