C18H23N3O4S2 — CID 23242186
(2E,4R,5S,6E)-7-[2-[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]-3,5-dimethoxy-4-methylhepta-2,6-dienamide (PubChem CID 23242186) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2E,4R,5S,6E)-7-[2-[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]-3,5-dimethoxy-4-methylhepta-2,6-dienamide.
| Compound Name | (2E,4R,5S,6E)-7-[2-[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]-3,5-dimethoxy-4-methylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 23242186 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2E,4R,5S,6E)-7-[2-[2-(1-hydroxyethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]-3,5-dimethoxy-4-methylhepta-2,6-dienamide |
| SMILES | CO/C(=C/C(N)=O)[C@H](C)[C@H](/C=C/c1csc(-c2csc(C(C)O)n2)n1)OC |
| InChI | InChI=1S/C18H23N3O4S2/c1-10(15(25-4)7-16(19)23)14(24-3)6-5-12-8-26-18(20-12)13-9-27-17(21-13)11(2)22/h5-11,14,22H,1-4H3,(H2,19,23)/b6-5+,15-7+/t10-,11?,14+/m1/s1 |
| InChIKey | ZJQOTAHSPZKZFD-IFRFMEILSA-N |
| XLogP | 3.00 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|