C25H35N3O3S2 — CID 5326795
(E,4S,5S)-3,5-dimethoxy-4-methyl-7-[2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hept-6-enamide (PubChem CID 5326795) has the molecular formula C25H35N3O3S2 and a molecular weight of 489.71 g/mol. Its IUPAC name is (E,4S,5S)-3,5-dimethoxy-4-methyl-7-[2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hept-6-enamide.
| Compound Name | (E,4S,5S)-3,5-dimethoxy-4-methyl-7-[2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hept-6-enamide |
|---|---|
| PubChem CID | 5326795 |
| Molecular Formula | C25H35N3O3S2 |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (E,4S,5S)-3,5-dimethoxy-4-methyl-7-[2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hept-6-enamide |
| SMILES | COC(CC(N)=O)[C@H](C)[C@H](/C=C/c1csc(-c2csc([C@@H](C)/C=C/C=C/C(C)C)n2)n1)OC |
| InChI | InChI=1S/C25H35N3O3S2/c1-16(2)9-7-8-10-17(3)24-28-20(15-33-24)25-27-19(14-32-25)11-12-21(30-5)18(4)22(31-6)13-23(26)29/h7-12,14-18,21-22H,13H2,1-6H3,(H2,26,29)/b9-7+,10-8+,12-11+/t17-,18+,21-,22?/m0/s1 |
| InChIKey | JWCIOBZQDUYSBS-VUSHGSQPSA-N |
| XLogP | 5.69 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|