C25H33N3O4S2 — CID 162926102
3,5-dimethoxy-4-methyl-7-[2-[2-[4-(3-propan-2-yloxiran-2-yl)but-3-en-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienamide (PubChem CID 162926102) has the molecular formula C25H33N3O4S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is 3,5-dimethoxy-4-methyl-7-[2-[2-[4-(3-propan-2-yloxiran-2-yl)but-3-en-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienamide.
| Compound Name | 3,5-dimethoxy-4-methyl-7-[2-[2-[4-(3-propan-2-yloxiran-2-yl)but-3-en-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienamide |
|---|---|
| PubChem CID | 162926102 |
| Molecular Formula | C25H33N3O4S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 3,5-dimethoxy-4-methyl-7-[2-[2-[4-(3-propan-2-yloxiran-2-yl)but-3-en-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienamide |
| SMILES | COC(=CC(N)=O)C(C)C(C=Cc1csc(-c2csc(C(C)C=CC3OC3C(C)C)n2)n1)OC |
| InChI | InChI=1S/C25H33N3O4S2/c1-14(2)23-20(32-23)9-7-15(3)24-28-18(13-34-24)25-27-17(12-33-25)8-10-19(30-5)16(4)21(31-6)11-22(26)29/h7-16,19-20,23H,1-6H3,(H2,26,29) |
| InChIKey | KCUOZRWMBFXFGA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|