C19H29NO4S — CID 101061314
(4E,6R,7S,8E)-9-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-5,7-dimethoxy-6-methylnona-4,8-dien-3-one (PubChem CID 101061314) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is (4E,6R,7S,8E)-9-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-5,7-dimethoxy-6-methylnona-4,8-dien-3-one.
| Compound Name | (4E,6R,7S,8E)-9-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-5,7-dimethoxy-6-methylnona-4,8-dien-3-one |
|---|---|
| PubChem CID | 101061314 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (4E,6R,7S,8E)-9-[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]-5,7-dimethoxy-6-methylnona-4,8-dien-3-one |
| SMILES | CCOC(C)c1nc(/C=C/[C@H](OC)[C@@H](C)/C(=C\C(=O)CC)OC)cs1 |
| InChI | InChI=1S/C19H29NO4S/c1-7-16(21)11-18(23-6)13(3)17(22-5)10-9-15-12-25-19(20-15)14(4)24-8-2/h9-14,17H,7-8H2,1-6H3/b10-9+,18-11+/t13-,14?,17+/m1/s1 |
| InChIKey | WCIFMSZTIFRFEB-RRYKFHKCSA-N |
| XLogP | 4.41 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|