C16H22NO4SY- — CID 59943982
(2E,6E)-3,5-dimethoxy-7-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dien-1-one;yttrium (PubChem CID 59943982) has the molecular formula C16H22NO4SY- and a molecular weight of 413.33 g/mol. Its IUPAC name is (2E,6E)-3,5-dimethoxy-7-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dien-1-one;yttrium.
| Compound Name | (2E,6E)-3,5-dimethoxy-7-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dien-1-one;yttrium |
|---|---|
| PubChem CID | 59943982 |
| Molecular Formula | C16H22NO4SY- |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | (2E,6E)-3,5-dimethoxy-7-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dien-1-one;yttrium |
| SMILES | CO/C(=C/[C-]=O)C(C)C(/C=C/c1csc(C(C)OC)n1)OC.[Y] |
| InChI | InChI=1S/C16H22NO4S.Y/c1-11(15(21-5)8-9-18)14(20-4)7-6-13-10-22-16(17-13)12(2)19-3;/h6-8,10-12,14H,1-5H3;/q-1;/b7-6+,15-8+; |
| InChIKey | DLKXISZGNCAFGD-RWYISRFSSA-N |
| XLogP | 3.15 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|