C16H20N2OS2 — CID 101413519
[2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]methanol (PubChem CID 101413519) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is [2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 101413519 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [2-[2-[(2S,3E,5E)-7-methylocta-3,5-dien-2-yl]-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]methanol |
| SMILES | CC(C)/C=C/C=C/[C@H](C)c1nc(-c2nc(CO)cs2)cs1 |
| InChI | InChI=1S/C16H20N2OS2/c1-11(2)6-4-5-7-12(3)15-18-14(10-21-15)16-17-13(8-19)9-20-16/h4-7,9-12,19H,8H2,1-3H3/b6-4+,7-5+/t12-/m0/s1 |
| InChIKey | BHJABOTWPJUAPV-HINGSUDXSA-N |
| XLogP | 4.63 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|