C20H26N2O5S2 — CID 162960499
methyl (4R,5S)-3,5-dimethoxy-4-methyl-7-[2-[(4R)-2-[(2S)-2-methyloxiran-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienoate (PubChem CID 162960499) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl (4R,5S)-3,5-dimethoxy-4-methyl-7-[2-[(4R)-2-[(2S)-2-methyloxiran-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienoate.
| Compound Name | methyl (4R,5S)-3,5-dimethoxy-4-methyl-7-[2-[(4R)-2-[(2S)-2-methyloxiran-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienoate |
|---|---|
| PubChem CID | 162960499 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | methyl (4R,5S)-3,5-dimethoxy-4-methyl-7-[2-[(4R)-2-[(2S)-2-methyloxiran-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hepta-2,6-dienoate |
| SMILES | COC(=O)C=C(OC)[C@H](C)[C@H](C=Cc1csc([C@H]2CSC([C@]3(C)CO3)=N2)n1)OC |
| InChI | InChI=1S/C20H26N2O5S2/c1-12(16(25-4)8-17(23)26-5)15(24-3)7-6-13-9-28-18(21-13)14-10-29-19(22-14)20(2)11-27-20/h6-9,12,14-15H,10-11H2,1-5H3/t12-,14-,15+,20+/m1/s1 |
| InChIKey | ZJXYLBWVBXQTFS-AUKZQPGHSA-N |
| XLogP | 3.49 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|