C40H62O — CID 163053852
2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,12,14,16,18,20,22,26,30-decaen-2-ol (PubChem CID 163053852) has the molecular formula C40H62O and a molecular weight of 558.94 g/mol. Its IUPAC name is 2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,12,14,16,18,20,22,26,30-decaen-2-ol.
| Compound Name | 2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,12,14,16,18,20,22,26,30-decaen-2-ol |
|---|---|
| PubChem CID | 163053852 |
| Molecular Formula | C40H62O |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.48 |
| IUPAC Name | 2,6,10,14,19,23,27,31-octamethyldotriaconta-6,10,12,14,16,18,20,22,26,30-decaen-2-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)CCC=C(C)CCCC(C)(C)O |
| InChI | InChI=1S/C40H62O/c1-33(2)19-13-22-36(5)25-16-28-37(6)26-14-23-34(3)20-11-12-21-35(4)24-15-27-38(7)29-17-30-39(8)31-18-32-40(9,10)41/h11-12,14-15,19-21,23-27,30,41H,13,16-18,22,28-29,31-32H2,1-10H3 |
| InChIKey | FUQQXWXMRWBZFM-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|