C29H28N2O7 — CID 163060481
6-acetyl-2-[1-[[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 163060481) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is 6-acetyl-2-[1-[[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | 6-acetyl-2-[1-[[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 163060481 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 6-acetyl-2-[1-[[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]amino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)NCCC(=O)N3CCc4ccccc43)C(=O)C12C |
| InChI | InChI=1S/C29H28N2O7/c1-14-25(35)23(16(3)32)27-24(26(14)36)29(4)20(38-27)13-19(33)22(28(29)37)15(2)30-11-9-21(34)31-12-10-17-7-5-6-8-18(17)31/h5-8,13,30,35-36H,9-12H2,1-4H3 |
| InChIKey | OJTAOWVJOTWDJJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|